C15H16N2 — CID 157463126
6-(2,3-dimethylphenyl)-1-methylpyrrolo[2,3-b]pyrrole (PubChem CID 157463126) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 6-(2,3-dimethylphenyl)-1-methylpyrrolo[2,3-b]pyrrole.
| Compound Name | 6-(2,3-dimethylphenyl)-1-methylpyrrolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 157463126 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-(2,3-dimethylphenyl)-1-methylpyrrolo[2,3-b]pyrrole |
| SMILES | Cc1cccc(-n2ccc3ccn(C)c32)c1C |
| InChI | InChI=1S/C15H16N2/c1-11-5-4-6-14(12(11)2)17-10-8-13-7-9-16(3)15(13)17/h4-10H,1-3H3 |
| InChIKey | RPSNBDBBDMOJAX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |