C30H30N+ — CID 157464896
1,5-dimethyl-2-(1-methyl-4-phenyl-9H-fluoren-2-yl)-4-propan-2-ylpyridin-1-ium (PubChem CID 157464896) has the molecular formula C30H30N+ and a molecular weight of 404.58 g/mol. Its IUPAC name is 1,5-dimethyl-2-(1-methyl-4-phenyl-9H-fluoren-2-yl)-4-propan-2-ylpyridin-1-ium.
| Compound Name | 1,5-dimethyl-2-(1-methyl-4-phenyl-9H-fluoren-2-yl)-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 157464896 |
| Molecular Formula | C30H30N+ |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1,5-dimethyl-2-(1-methyl-4-phenyl-9H-fluoren-2-yl)-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2cc(-c3ccccc3)c3c(c2C)Cc2ccccc2-3)cc1C(C)C |
| InChI | InChI=1S/C30H30N/c1-19(2)25-17-29(31(5)18-20(25)3)26-16-28(22-11-7-6-8-12-22)30-24-14-10-9-13-23(24)15-27(30)21(26)4/h6-14,16-19H,15H2,1-5H3/q+1 |
| InChIKey | GORDFFRSOBOXTD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|