About O-methyl ethanethioate;O-methyl N-methylcarbamothioate
O-methyl ethanethioate;O-methyl N-methylcarbamothioate (PubChem CID 157473236) has the molecular formula C6H13NO2S2
and a molecular weight of 195.31 g/mol. Its IUPAC name is O-methyl ethanethioate;O-methyl N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-methyl ethanethioate;O-methyl N-methylcarbamothioate |
| PubChem CID | 157473236 |
| Molecular Formula | C6H13NO2S2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | O-methyl ethanethioate;O-methyl N-methylcarbamothioate |
| SMILES | CNC(=S)OC.COC(C)=S |
| InChI | InChI=1S/C3H7NOS.C3H6OS/c1-4-3(6)5-2;1-3(5)4-2/h1-2H3,(H,4,6);1-2H3 |
| InChIKey | BVHBROWGSNJCSP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl ethanethioate;O-methyl N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl ethanethioate;O-methyl N-methylcarbamothioate?
The IUPAC name of O-methyl ethanethioate;O-methyl N-methylcarbamothioate (CID 157473236) is O-methyl ethanethioate;O-methyl N-methylcarbamothioate.
What is the SMILES notation for O-methyl ethanethioate;O-methyl N-methylcarbamothioate?
The canonical SMILES for O-methyl ethanethioate;O-methyl N-methylcarbamothioate is CNC(=S)OC.COC(C)=S.
What is the InChIKey of O-methyl ethanethioate;O-methyl N-methylcarbamothioate?
The InChIKey is BVHBROWGSNJCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NOS.C3H6OS/c1-4-3(6)5-2;1-3(5)4-2/h1-2H3,(H,4,6);1-2H3.
What are the key properties of O-methyl ethanethioate;O-methyl N-methylcarbamothioate?
O-methyl ethanethioate;O-methyl N-methylcarbamothioate has a molecular weight of 195.31 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl ethanethioate;O-methyl N-methylcarbamothioate is sourced from PubChem (CID 157473236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).