C18H11F5O3 — CID 157474074
3-[4-[2-(3,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)prop-2-enoyl]phenyl]prop-2-enoic acid (PubChem CID 157474074) has the molecular formula C18H11F5O3 and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-[4-[2-(3,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)prop-2-enoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(3,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)prop-2-enoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 157474074 |
| Molecular Formula | C18H11F5O3 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3-[4-[2-(3,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)prop-2-enoyl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)c1ccc(C=CC(=O)O)cc1)C1=CC(F)(F)C(F)C(F)=C1F |
| InChI | InChI=1S/C18H11F5O3/c1-9(12-8-18(22,23)17(21)15(20)14(12)19)16(26)11-5-2-10(3-6-11)4-7-13(24)25/h2-8,17H,1H2,(H,24,25) |
| InChIKey | BVJMTKYNTGVUHH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|