C29H39ClN2O5 — CID 157476571
(16E,18E)-11-chloro-6,21-dihydroxy-2,5,9,12,16,20-hexamethyl-23-methylidene-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-8-one (PubChem CID 157476571) has the molecular formula C29H39ClN2O5 and a molecular weight of 531.09 g/mol. Its IUPAC name is (16E,18E)-11-chloro-6,21-dihydroxy-2,5,9,12,16,20-hexamethyl-23-methylidene-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-8-one.
| Compound Name | (16E,18E)-11-chloro-6,21-dihydroxy-2,5,9,12,16,20-hexamethyl-23-methylidene-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-8-one |
|---|---|
| PubChem CID | 157476571 |
| Molecular Formula | C29H39ClN2O5 |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (16E,18E)-11-chloro-6,21-dihydroxy-2,5,9,12,16,20-hexamethyl-23-methylidene-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-8-one |
| SMILES | C=C1NC2(O)CC(O1)C(C)C1OC1(C)C(O)CC(=O)N(C)c1cc(cc(C)c1Cl)C/C(C)=C/C=C/C2C |
| InChI | InChI=1S/C29H39ClN2O5/c1-16-9-8-10-18(3)29(35)15-23(36-20(5)31-29)19(4)27-28(6,37-27)24(33)14-25(34)32(7)22-13-21(11-16)12-17(2)26(22)30/h8-10,12-13,18-19,23-24,27,31,33,35H,5,11,14-15H2,1-4,6-7H3/b10-8+,16-9+ |
| InChIKey | OBFWNGJFMGKCBX-VYWHLGQJSA-N |
| XLogP | 4.39 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|