C28H37ClN2O5 — CID 90451626
(1R,16E,18E,21S)-11-chloro-6,21-dihydroxy-5,9,12,16,20-pentamethyl-24-oxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 90451626) has the molecular formula C28H37ClN2O5 and a molecular weight of 517.07 g/mol. Its IUPAC name is (1R,16E,18E,21S)-11-chloro-6,21-dihydroxy-5,9,12,16,20-pentamethyl-24-oxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (1R,16E,18E,21S)-11-chloro-6,21-dihydroxy-5,9,12,16,20-pentamethyl-24-oxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 90451626 |
| Molecular Formula | C28H37ClN2O5 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (1R,16E,18E,21S)-11-chloro-6,21-dihydroxy-5,9,12,16,20-pentamethyl-24-oxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | C/C1=C\C=C\C(C)[C@@]2(O)C[C@@H](CC3CC3(C)C(O)CC(=O)N(C)c3cc(cc(C)c3Cl)C1)OC(=O)N2 |
| InChI | InChI=1S/C28H37ClN2O5/c1-16-7-6-8-18(3)28(35)15-21(36-26(34)30-28)12-20-14-27(20,4)23(32)13-24(33)31(5)22-11-19(9-16)10-17(2)25(22)29/h6-8,10-11,18,20-21,23,32,35H,9,12-15H2,1-5H3,(H,30,34)/b8-6+,16-7+/t18?,20?,21-,23?,27?,28+/m1/s1 |
| InChIKey | GRPPBZAVOWRNEJ-KAZYTPGNSA-N |
| XLogP | 4.66 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |