C15H20N2O8 — CID 157477588
N-(1,3-dihydroxypropan-2-yl)-3-[4-hydroxy-3-(hydroxymethyl)butanoyl]-5-nitrobenzamide (PubChem CID 157477588) has the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-[4-hydroxy-3-(hydroxymethyl)butanoyl]-5-nitrobenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-[4-hydroxy-3-(hydroxymethyl)butanoyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 157477588 |
| Molecular Formula | C15H20N2O8 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-[4-hydroxy-3-(hydroxymethyl)butanoyl]-5-nitrobenzamide |
| SMILES | O=C(CC(CO)CO)c1cc(C(=O)NC(CO)CO)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N2O8/c18-5-9(6-19)1-14(22)10-2-11(4-13(3-10)17(24)25)15(23)16-12(7-20)8-21/h2-4,9,12,18-21H,1,5-8H2,(H,16,23) |
| InChIKey | BVTWERDPJMFTPT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 170.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|