C28H46N4O7 — CID 15965449
3-N-[(4S,5S,7R)-5-hydroxy-2,7-dimethyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-1-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 15965449) has the molecular formula C28H46N4O7 and a molecular weight of 550.70 g/mol. Its IUPAC name is 3-N-[(4S,5S,7R)-5-hydroxy-2,7-dimethyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-1-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 3-N-[(4S,5S,7R)-5-hydroxy-2,7-dimethyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-1-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 15965449 |
| Molecular Formula | C28H46N4O7 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | 3-N-[(4S,5S,7R)-5-hydroxy-2,7-dimethyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-1-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | CC(C)CNC(=O)[C@H](C)C[C@H](O)[C@H](CC(C)C)NC(=O)c1cc(C(=O)N[C@H](CO)CC(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H46N4O7/c1-16(2)8-22(15-33)30-27(36)20-11-21(13-23(12-20)32(38)39)28(37)31-24(9-17(3)4)25(34)10-19(7)26(35)29-14-18(5)6/h11-13,16-19,22,24-25,33-34H,8-10,14-15H2,1-7H3,(H,29,35)(H,30,36)(H,31,37)/t19-,22+,24+,25+/m1/s1 |
| InChIKey | MPQDBDGRVKJIPW-FISOAXRRSA-N |
| XLogP | 3.04 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|