C26H14Br3NO — CID 157479875
8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene (PubChem CID 157479875) has the molecular formula C26H14Br3NO and a molecular weight of 596.12 g/mol. Its IUPAC name is 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene.
| Compound Name | 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene |
|---|---|
| PubChem CID | 157479875 |
| Molecular Formula | C26H14Br3NO |
| Molecular Weight | 596.12 g/mol |
| Exact Mass | 592.86 |
| IUPAC Name | 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene |
| SMILES | Brc1ccc2c(c1)-c1cc(Br)ccc1C2.N#Cc1ccc2oc3ccc(Br)cc3c2c1 |
| InChI | InChI=1S/C13H8Br2.C13H6BrNO/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;14-9-2-4-13-11(6-9)10-5-8(7-15)1-3-12(10)16-13/h1-4,6-7H,5H2;1-6H |
| InChIKey | BWAQOAWCMCGOIL-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.12 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |