About 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene
8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene (PubChem CID 157479875) has the molecular formula C26H14Br3NO
and a molecular weight of 596.12 g/mol. Its IUPAC name is 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene.
Molecular Properties
| Compound Name | 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene |
| PubChem CID | 157479875 |
| Molecular Formula | C26H14Br3NO |
| Molecular Weight | 596.12 g/mol |
| Exact Mass | 592.86 |
| IUPAC Name | 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene |
| SMILES | Brc1ccc2c(c1)-c1cc(Br)ccc1C2.N#Cc1ccc2oc3ccc(Br)cc3c2c1 |
| InChI | InChI=1S/C13H8Br2.C13H6BrNO/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;14-9-2-4-13-11(6-9)10-5-8(7-15)1-3-12(10)16-13/h1-4,6-7H,5H2;1-6H |
| InChIKey | BWAQOAWCMCGOIL-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 596.12 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene?
The IUPAC name of 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene (CID 157479875) is 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene.
What is the SMILES notation for 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene?
The canonical SMILES for 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene is Brc1ccc2c(c1)-c1cc(Br)ccc1C2.N#Cc1ccc2oc3ccc(Br)cc3c2c1.
What is the InChIKey of 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene?
The InChIKey is BWAQOAWCMCGOIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2.C13H6BrNO/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;14-9-2-4-13-11(6-9)10-5-8(7-15)1-3-12(10)16-13/h1-4,6-7H,5H2;1-6H.
What are the key properties of 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene?
8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene has a molecular weight of 596.12 g/mol, XLogP of 9.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromodibenzofuran-2-carbonitrile;3,6-dibromo-9H-fluorene is sourced from PubChem (CID 157479875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).