About 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate
2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate (PubChem CID 157480284) has the molecular formula C16H12Br2Cl2O4
and a molecular weight of 498.98 g/mol. Its IUPAC name is 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate.
Molecular Properties
| Compound Name | 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate |
| PubChem CID | 157480284 |
| Molecular Formula | C16H12Br2Cl2O4 |
| Molecular Weight | 498.98 g/mol |
| Exact Mass | 495.85 |
| IUPAC Name | 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1Br.Cc1cc(Cl)cc(C(=O)O)c1Br |
| InChI | InChI=1S/2C8H6BrClO2/c1-4-2-5(10)3-6(7(4)9)8(11)12;1-12-8(11)6-4-5(10)2-3-7(6)9/h2-3H,1H3,(H,11,12);2-4H,1H3 |
| InChIKey | BWBUMZUOEKJPGN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.98 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate?
The IUPAC name of 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate (CID 157480284) is 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate.
What is the SMILES notation for 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate?
The canonical SMILES for 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate is COC(=O)c1cc(Cl)ccc1Br.Cc1cc(Cl)cc(C(=O)O)c1Br.
What is the InChIKey of 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate?
The InChIKey is BWBUMZUOEKJPGN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6BrClO2/c1-4-2-5(10)3-6(7(4)9)8(11)12;1-12-8(11)6-4-5(10)2-3-7(6)9/h2-3H,1H3,(H,11,12);2-4H,1H3.
What are the key properties of 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate?
2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate has a molecular weight of 498.98 g/mol, XLogP of 6.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-chloro-3-methylbenzoic acid;methyl 2-bromo-5-chlorobenzoate is sourced from PubChem (CID 157480284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).