C40H47N3 — CID 157482198
4-[4-[9-(3-hexylphenyl)-4-isocyano-2,7-dimethylfluoren-9-yl]butyl]-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 157482198) has the molecular formula C40H47N3 and a molecular weight of 569.84 g/mol. Its IUPAC name is 4-[4-[9-(3-hexylphenyl)-4-isocyano-2,7-dimethylfluoren-9-yl]butyl]-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-[4-[9-(3-hexylphenyl)-4-isocyano-2,7-dimethylfluoren-9-yl]butyl]-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 157482198 |
| Molecular Formula | C40H47N3 |
| Molecular Weight | 569.84 g/mol |
| Exact Mass | 569.38 |
| IUPAC Name | 4-[4-[9-(3-hexylphenyl)-4-isocyano-2,7-dimethylfluoren-9-yl]butyl]-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | [C-]#[N+]c1cc(C)cc2c1-c1ccc(C)cc1C2(CCCCc1ccc(NC)c(NC)c1)c1cccc(CCCCCC)c1 |
| InChI | InChI=1S/C40H47N3/c1-7-8-9-10-14-30-16-13-17-32(26-30)40(22-12-11-15-31-19-21-36(41-4)37(27-31)42-5)34-23-28(2)18-20-33(34)39-35(40)24-29(3)25-38(39)43-6/h13,16-21,23-27,41-42H,7-12,14-15,22H2,1-5H3 |
| InChIKey | QDIJVQVDCXQFKZ-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 28.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.84 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|