C32H37F3O8S — CID 157482622
methyl 3-tert-butyl-4-(3-methoxyphenyl)benzoate;methyl 3-tert-butyl-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 157482622) has the molecular formula C32H37F3O8S and a molecular weight of 638.70 g/mol. Its IUPAC name is methyl 3-tert-butyl-4-(3-methoxyphenyl)benzoate;methyl 3-tert-butyl-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 3-tert-butyl-4-(3-methoxyphenyl)benzoate;methyl 3-tert-butyl-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 157482622 |
| Molecular Formula | C32H37F3O8S |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | methyl 3-tert-butyl-4-(3-methoxyphenyl)benzoate;methyl 3-tert-butyl-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(OC)c2)c(C(C)(C)C)c1.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H22O3.C13H15F3O5S/c1-19(2,3)17-12-14(18(20)22-5)9-10-16(17)13-7-6-8-15(11-13)21-4;1-12(2,3)9-7-8(11(17)20-4)5-6-10(9)21-22(18,19)13(14,15)16/h6-12H,1-5H3;5-7H,1-4H3 |
| InChIKey | BWIIXMQXPZAQFZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|