C14H22O6S — CID 157484951
[(1S)-1-(3,6-dioxoheptan-2-ylsulfanylcarbonyloxy)ethyl] 2-methylpropanoate (PubChem CID 157484951) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is [(1S)-1-(3,6-dioxoheptan-2-ylsulfanylcarbonyloxy)ethyl] 2-methylpropanoate.
| Compound Name | [(1S)-1-(3,6-dioxoheptan-2-ylsulfanylcarbonyloxy)ethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 157484951 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [(1S)-1-(3,6-dioxoheptan-2-ylsulfanylcarbonyloxy)ethyl] 2-methylpropanoate |
| SMILES | CC(=O)CCC(=O)C(C)SC(=O)O[C@@H](C)OC(=O)C(C)C |
| InChI | InChI=1S/C14H22O6S/c1-8(2)13(17)19-11(5)20-14(18)21-10(4)12(16)7-6-9(3)15/h8,10-11H,6-7H2,1-5H3/t10?,11-/m0/s1 |
| InChIKey | QBTNHASFCOMFOY-DTIOYNMSSA-N |
| XLogP | 2.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|