C24H31N7O5 — CID 157487765
14-benzyl-3,6,12,15-tetraoxo-1,4,7,16,20,21-hexazatricyclo[17.2.1.07,11]docos-19(22)-ene-17-carboxamide (PubChem CID 157487765) has the molecular formula C24H31N7O5 and a molecular weight of 497.56 g/mol. Its IUPAC name is 14-benzyl-3,6,12,15-tetraoxo-1,4,7,16,20,21-hexazatricyclo[17.2.1.07,11]docos-19(22)-ene-17-carboxamide.
| Compound Name | 14-benzyl-3,6,12,15-tetraoxo-1,4,7,16,20,21-hexazatricyclo[17.2.1.07,11]docos-19(22)-ene-17-carboxamide |
|---|---|
| PubChem CID | 157487765 |
| Molecular Formula | C24H31N7O5 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 14-benzyl-3,6,12,15-tetraoxo-1,4,7,16,20,21-hexazatricyclo[17.2.1.07,11]docos-19(22)-ene-17-carboxamide |
| SMILES | NC(=O)C1CC2=CN(CC(=O)NCC(=O)N3CCCC3C(=O)CC(Cc3ccccc3)C(=O)N1)NN2 |
| InChI | InChI=1S/C24H31N7O5/c25-23(35)18-11-17-13-30(29-28-17)14-21(33)26-12-22(34)31-8-4-7-19(31)20(32)10-16(24(36)27-18)9-15-5-2-1-3-6-15/h1-3,5-6,13,16,18-19,28-29H,4,7-12,14H2,(H2,25,35)(H,26,33)(H,27,36) |
| InChIKey | IXLCYMIKOLPACN-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |