C29H41N9O7 — CID 90683213
(8Z,13S,16S,19S)-6-amino-13-benzyl-16-[3-(diaminomethylideneamino)propyl]-2,5,12,15,18-pentaoxo-1,4,11,14,17-pentazabicyclo[17.3.0]docos-8-ene-10-carboxylic acid (PubChem CID 90683213) has the molecular formula C29H41N9O7 and a molecular weight of 627.70 g/mol. Its IUPAC name is (8Z,13S,16S,19S)-6-amino-13-benzyl-16-[3-(diaminomethylideneamino)propyl]-2,5,12,15,18-pentaoxo-1,4,11,14,17-pentazabicyclo[17.3.0]docos-8-ene-10-carboxylic acid.
| Compound Name | (8Z,13S,16S,19S)-6-amino-13-benzyl-16-[3-(diaminomethylideneamino)propyl]-2,5,12,15,18-pentaoxo-1,4,11,14,17-pentazabicyclo[17.3.0]docos-8-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 90683213 |
| Molecular Formula | C29H41N9O7 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | (8Z,13S,16S,19S)-6-amino-13-benzyl-16-[3-(diaminomethylideneamino)propyl]-2,5,12,15,18-pentaoxo-1,4,11,14,17-pentazabicyclo[17.3.0]docos-8-ene-10-carboxylic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)CNC(=O)C(N)C/C=C\C(C(=O)O)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C29H41N9O7/c30-18-9-4-10-20(28(44)45)36-26(42)21(15-17-7-2-1-3-8-17)37-25(41)19(11-5-13-33-29(31)32)35-27(43)22-12-6-14-38(22)23(39)16-34-24(18)40/h1-4,7-8,10,18-22H,5-6,9,11-16,30H2,(H,34,40)(H,35,43)(H,36,42)(H,37,41)(H,44,45)(H4,31,32,33)/b10-4-/t18?,19-,20?,21-,22-/m0/s1 |
| InChIKey | DZOXTYNHYPCGJB-KRCCCHSNSA-N |
| XLogP | -2.78 |
| TPSA | 264.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|