C21H29NO7 — CID 15749582
1-O,1-O-diethyl 2-O-propan-2-yl 3-benzamido-1-methylpropane-1,1,2-tricarboxylate (PubChem CID 15749582) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-O,1-O-diethyl 2-O-propan-2-yl 3-benzamido-1-methylpropane-1,1,2-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 2-O-propan-2-yl 3-benzamido-1-methylpropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 15749582 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-O,1-O-diethyl 2-O-propan-2-yl 3-benzamido-1-methylpropane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C(CNC(=O)c1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C21H29NO7/c1-6-27-19(25)21(5,20(26)28-7-2)16(18(24)29-14(3)4)13-22-17(23)15-11-9-8-10-12-15/h8-12,14,16H,6-7,13H2,1-5H3,(H,22,23) |
| InChIKey | JFUNPBMQGWLMSK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|