C18H26N2O4S — CID 90111327
ethyl 2-[(2-benzamidoacetyl)amino]-2-tert-butylsulfanylpropanoate (PubChem CID 90111327) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is ethyl 2-[(2-benzamidoacetyl)amino]-2-tert-butylsulfanylpropanoate.
| Compound Name | ethyl 2-[(2-benzamidoacetyl)amino]-2-tert-butylsulfanylpropanoate |
|---|---|
| PubChem CID | 90111327 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl 2-[(2-benzamidoacetyl)amino]-2-tert-butylsulfanylpropanoate |
| SMILES | CCOC(=O)C(C)(NC(=O)CNC(=O)c1ccccc1)SC(C)(C)C |
| InChI | InChI=1S/C18H26N2O4S/c1-6-24-16(23)18(5,25-17(2,3)4)20-14(21)12-19-15(22)13-10-8-7-9-11-13/h7-11H,6,12H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | JHIHCYXSJNMSBO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|