C14H18Br3F12NO4Si — CID 157499736
[2-(bromomethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-trimethylsilane;2-(bromomethyl)-3,3,3-trifluoro-2-hydroxypropanamide;3-bromo-1,1,1-trifluoropropan-2-one (PubChem CID 157499736) has the molecular formula C14H18Br3F12NO4Si and a molecular weight of 760.07 g/mol. Its IUPAC name is [2-(bromomethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-trimethylsilane;2-(bromomethyl)-3,3,3-trifluoro-2-hydroxypropanamide;3-bromo-1,1,1-trifluoropropan-2-one.
| Compound Name | [2-(bromomethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-trimethylsilane;2-(bromomethyl)-3,3,3-trifluoro-2-hydroxypropanamide;3-bromo-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 157499736 |
| Molecular Formula | C14H18Br3F12NO4Si |
| Molecular Weight | 760.07 g/mol |
| Exact Mass | 756.84 |
| IUPAC Name | [2-(bromomethyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-trimethylsilane;2-(bromomethyl)-3,3,3-trifluoro-2-hydroxypropanamide;3-bromo-1,1,1-trifluoropropan-2-one |
| SMILES | C[Si](C)(C)OC(CBr)(C(F)(F)F)C(F)(F)F.NC(=O)C(O)(CBr)C(F)(F)F.O=C(CBr)C(F)(F)F |
| InChI | InChI=1S/C7H11BrF6OSi.C4H5BrF3NO2.C3H2BrF3O/c1-16(2,3)15-5(4-8,6(9,10)11)7(12,13)14;5-1-3(11,2(9)10)4(6,7)8;4-1-2(8)3(5,6)7/h4H2,1-3H3;11H,1H2,(H2,9,10);1H2 |
| InChIKey | BYGOKNDSNMNXOJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.07 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|