C10H12Br2O2 — CID 15760230
1,4-bis(bromomethyl)-2,3-dimethoxybenzene (PubChem CID 15760230) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,3-dimethoxybenzene.
| Compound Name | 1,4-bis(bromomethyl)-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 15760230 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,3-dimethoxybenzene |
| SMILES | COc1c(CBr)ccc(CBr)c1OC |
| InChI | InChI=1S/C10H12Br2O2/c1-13-9-7(5-11)3-4-8(6-12)10(9)14-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | LNGRQUARTUIUNT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|