About 2-phenylpropanenitrile
2-phenylpropanenitrile (PubChem CID 15761) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-phenylpropanenitrile.
Molecular Properties
| Compound Name | 2-phenylpropanenitrile |
| PubChem CID | 15761 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 2-phenylpropanenitrile |
| SMILES | CC(C#N)c1ccccc1 |
| InChI | InChI=1S/C9H9N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,1H3 |
| InChIKey | NVAOLENBKNECGF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropanenitrile?
The IUPAC name of 2-phenylpropanenitrile (CID 15761) is 2-phenylpropanenitrile.
What is the SMILES notation for 2-phenylpropanenitrile?
The canonical SMILES for 2-phenylpropanenitrile is CC(C#N)c1ccccc1.
What is the InChIKey of 2-phenylpropanenitrile?
The InChIKey is NVAOLENBKNECGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,1H3.
What are the key properties of 2-phenylpropanenitrile?
2-phenylpropanenitrile has a molecular weight of 131.18 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropanenitrile is sourced from PubChem (CID 15761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).