C17H17P — CID 15791199
pent-4-ynyl(diphenyl)phosphane (PubChem CID 15791199) has the molecular formula C17H17P and a molecular weight of 252.30 g/mol. Its IUPAC name is pent-4-ynyl(diphenyl)phosphane.
| Compound Name | pent-4-ynyl(diphenyl)phosphane |
|---|---|
| PubChem CID | 15791199 |
| Molecular Formula | C17H17P |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | pent-4-ynyl(diphenyl)phosphane |
| SMILES | C#CCCCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17P/c1-2-3-10-15-18(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h1,4-9,11-14H,3,10,15H2 |
| InChIKey | QIIJLEDKDLNPNA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|