C17H32O4 — CID 158017782
ethyl 3,3-dimethylpentanoate;ethyl (Z)-3-methylpent-2-enoate (PubChem CID 158017782) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethyl 3,3-dimethylpentanoate;ethyl (Z)-3-methylpent-2-enoate.
| Compound Name | ethyl 3,3-dimethylpentanoate;ethyl (Z)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 158017782 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | ethyl 3,3-dimethylpentanoate;ethyl (Z)-3-methylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)CC.CCOC(=O)CC(C)(C)CC |
| InChI | InChI=1S/C9H18O2.C8H14O2/c1-5-9(3,4)7-8(10)11-6-2;1-4-7(3)6-8(9)10-5-2/h5-7H2,1-4H3;6H,4-5H2,1-3H3/b;7-6- |
| InChIKey | FFRKODBMRRQYSA-VDXOJYAPSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|