C60H57O2S3+3 — CID 158021344
4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenol;5-(4-hexoxy-3,5-dimethylphenyl)dibenzothiophen-5-ium;1-phenyl-1-benzothiophen-1-ium (PubChem CID 158021344) has the molecular formula C60H57O2S3+3 and a molecular weight of 906.31 g/mol. Its IUPAC name is 4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenol;5-(4-hexoxy-3,5-dimethylphenyl)dibenzothiophen-5-ium;1-phenyl-1-benzothiophen-1-ium.
| Compound Name | 4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenol;5-(4-hexoxy-3,5-dimethylphenyl)dibenzothiophen-5-ium;1-phenyl-1-benzothiophen-1-ium |
|---|---|
| PubChem CID | 158021344 |
| Molecular Formula | C60H57O2S3+3 |
| Molecular Weight | 906.31 g/mol |
| Exact Mass | 905.35 |
| IUPAC Name | 4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenol;5-(4-hexoxy-3,5-dimethylphenyl)dibenzothiophen-5-ium;1-phenyl-1-benzothiophen-1-ium |
| SMILES | CCCCCCOc1c(C)cc(-[s+]2c3ccccc3c3ccccc32)cc1C.Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1O.c1ccc(-[s+]2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C26H29OS.C20H16OS.C14H11S/c1-4-5-6-11-16-27-26-19(2)17-21(18-20(26)3)28-24-14-9-7-12-22(24)23-13-8-10-15-25(23)28;1-13-11-15(12-14(2)20(13)21)22-18-9-5-3-7-16(18)17-8-4-6-10-19(17)22;1-2-7-13(8-3-1)15-11-10-12-6-4-5-9-14(12)15/h7-10,12-15,17-18H,4-6,11,16H2,1-3H3;3-12H,1-2H3;1-11H/q+1;;+1/p+1 |
| InChIKey | FGCFNFIXRNXYKB-UHFFFAOYSA-O |
| XLogP | 18.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.31 |
| LogP ≤ 5 | 18.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|