C35H40BBr2N3O2 — CID 158021755
6-bromo-1,4-dimethylindole;6-bromo-4-methyl-1H-indole;1,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 158021755) has the molecular formula C35H40BBr2N3O2 and a molecular weight of 705.34 g/mol. Its IUPAC name is 6-bromo-1,4-dimethylindole;6-bromo-4-methyl-1H-indole;1,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1,4-dimethylindole;6-bromo-4-methyl-1H-indole;1,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 158021755 |
| Molecular Formula | C35H40BBr2N3O2 |
| Molecular Weight | 705.34 g/mol |
| Exact Mass | 703.16 |
| IUPAC Name | 6-bromo-1,4-dimethylindole;6-bromo-4-methyl-1H-indole;1,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1ccn2C.Cc1cc(Br)cc2[nH]ccc12.Cc1cc(Br)cc2c1ccn2C |
| InChI | InChI=1S/C16H22BNO2.C10H10BrN.C9H8BrN/c1-11-9-12(10-14-13(11)7-8-18(14)6)17-19-15(2,3)16(4,5)20-17;1-7-5-8(11)6-10-9(7)3-4-12(10)2;1-6-4-7(10)5-9-8(6)2-3-11-9/h7-10H,1-6H3;3-6H,1-2H3;2-5,11H,1H3 |
| InChIKey | FGDKQFLZDYDOBT-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 44.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.34 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|