C34H52Cl2N6O5 — CID 158025291
bis(tert-butyl 4-(3-chloro-4-pyridinyl)-1,4-diazepane-1-carboxylate);oxolane (PubChem CID 158025291) has the molecular formula C34H52Cl2N6O5 and a molecular weight of 695.73 g/mol. Its IUPAC name is bis(tert-butyl 4-(3-chloro-4-pyridinyl)-1,4-diazepane-1-carboxylate);oxolane.
| Compound Name | bis(tert-butyl 4-(3-chloro-4-pyridinyl)-1,4-diazepane-1-carboxylate);oxolane |
|---|---|
| PubChem CID | 158025291 |
| Molecular Formula | C34H52Cl2N6O5 |
| Molecular Weight | 695.73 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | bis(tert-butyl 4-(3-chloro-4-pyridinyl)-1,4-diazepane-1-carboxylate);oxolane |
| SMILES | C1CCOC1.CC(C)(C)OC(=O)N1CCCN(c2ccncc2Cl)CC1.CC(C)(C)OC(=O)N1CCCN(c2ccncc2Cl)CC1 |
| InChI | InChI=1S/2C15H22ClN3O2.C4H8O/c2*1-15(2,3)21-14(20)19-8-4-7-18(9-10-19)13-5-6-17-11-12(13)16;1-2-4-5-3-1/h2*5-6,11H,4,7-10H2,1-3H3;1-4H2 |
| InChIKey | FGNNUIQKCQKTSO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |