C14H22B44N4O2 — CID 157274029
CID 157274029 (PubChem CID 157274029) has the molecular formula C14H22B44N4O2 and a molecular weight of 754.08 g/mol.
| Compound Name | CID 157274029 |
|---|---|
| PubChem CID | 157274029 |
| Molecular Formula | C14H22B44N4O2 |
| Molecular Weight | 754.08 g/mol |
| Exact Mass | 762.58 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ccncc2N)C1.[B]B([B])B([B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C14H22N4O2.B44/c1-14(2,3)20-13(19)18-8-4-7-17(10-18)12-5-6-16-9-11(12)15;1-24(2)35(23)41(36(25(3)4)26(5)6)44(42(37(27(7)8)28(9)10)38(29(11)12)30(13)14)43(39(31(15)16)32(17)18)40(33(19)20)34(21)22/h5-6,9H,4,7-8,10,15H2,1-3H3; |
| InChIKey | NGVQKFABJNXORR-UHFFFAOYSA-N |
| XLogP | -14.69 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.08 |
| LogP ≤ 5 | -14.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|