C27H30F4N2O5S — CID 158039591
(4R,7R)-1-cyclopropyl-4-ethyl-8-(pyridin-3-ylmethylsulfonyl)-7-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]octane-2,3,6-trione (PubChem CID 158039591) has the molecular formula C27H30F4N2O5S and a molecular weight of 570.61 g/mol. Its IUPAC name is (4R,7R)-1-cyclopropyl-4-ethyl-8-(pyridin-3-ylmethylsulfonyl)-7-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]octane-2,3,6-trione.
| Compound Name | (4R,7R)-1-cyclopropyl-4-ethyl-8-(pyridin-3-ylmethylsulfonyl)-7-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]octane-2,3,6-trione |
|---|---|
| PubChem CID | 158039591 |
| Molecular Formula | C27H30F4N2O5S |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (4R,7R)-1-cyclopropyl-4-ethyl-8-(pyridin-3-ylmethylsulfonyl)-7-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]octane-2,3,6-trione |
| SMILES | CC[C@H](CC(=O)[C@H](CS(=O)(=O)Cc1cccnc1)N[C@@H](c1ccc(F)cc1)C(F)(F)F)C(=O)C(=O)CC1CC1 |
| InChI | InChI=1S/C27H30F4N2O5S/c1-2-19(25(36)24(35)12-17-5-6-17)13-23(34)22(16-39(37,38)15-18-4-3-11-32-14-18)33-26(27(29,30)31)20-7-9-21(28)10-8-20/h3-4,7-11,14,17,19,22,26,33H,2,5-6,12-13,15-16H2,1H3/t19-,22+,26+/m1/s1 |
| InChIKey | KJNOQARXUPDAHT-GSPPDTAYSA-N |
| XLogP | 4.32 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|