C25H31F4N5O3 — CID 162205896
(2S,5R)-5-(cyclobutylmethyl)-9-methyl-1-(2H-tetrazol-5-yl)-2-[[(1S)-2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]amino]decane-3,6,7-trione (PubChem CID 162205896) has the molecular formula C25H31F4N5O3 and a molecular weight of 525.55 g/mol. Its IUPAC name is (2S,5R)-5-(cyclobutylmethyl)-9-methyl-1-(2H-tetrazol-5-yl)-2-[[(1S)-2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]amino]decane-3,6,7-trione.
| Compound Name | (2S,5R)-5-(cyclobutylmethyl)-9-methyl-1-(2H-tetrazol-5-yl)-2-[[(1S)-2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]amino]decane-3,6,7-trione |
|---|---|
| PubChem CID | 162205896 |
| Molecular Formula | C25H31F4N5O3 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (2S,5R)-5-(cyclobutylmethyl)-9-methyl-1-(2H-tetrazol-5-yl)-2-[[(1S)-2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]amino]decane-3,6,7-trione |
| SMILES | CC(C)CC(=O)C(=O)[C@@H](CC(=O)[C@H](Cc1nn[nH]n1)N[C@@H](c1cccc(F)c1)C(F)(F)F)CC1CCC1 |
| InChI | InChI=1S/C25H31F4N5O3/c1-14(2)9-21(36)23(37)17(10-15-5-3-6-15)12-20(35)19(13-22-31-33-34-32-22)30-24(25(27,28)29)16-7-4-8-18(26)11-16/h4,7-8,11,14-15,17,19,24,30H,3,5-6,9-10,12-13H2,1-2H3,(H,31,32,33,34)/t17-,19+,24+/m1/s1 |
| InChIKey | IOAOZQHVHJDXCJ-VUMVONDWSA-N |
| XLogP | 4.09 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|