C23H37N7O6 — CID 158044511
N'-[4-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-[4-(carbamoylamino)phenyl]propanoyl]amino]butyl]-2-methylpentanediamide (PubChem CID 158044511) has the molecular formula C23H37N7O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is N'-[4-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-[4-(carbamoylamino)phenyl]propanoyl]amino]butyl]-2-methylpentanediamide.
| Compound Name | N'-[4-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-[4-(carbamoylamino)phenyl]propanoyl]amino]butyl]-2-methylpentanediamide |
|---|---|
| PubChem CID | 158044511 |
| Molecular Formula | C23H37N7O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | N'-[4-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-[4-(carbamoylamino)phenyl]propanoyl]amino]butyl]-2-methylpentanediamide |
| SMILES | CC(CCC(=O)NCCCCNC(=O)C(Cc1ccc(NC(N)=O)cc1)NC(=O)C(N)CO)C(N)=O |
| InChI | InChI=1S/C23H37N7O6/c1-14(20(25)33)4-9-19(32)27-10-2-3-11-28-22(35)18(30-21(34)17(24)13-31)12-15-5-7-16(8-6-15)29-23(26)36/h5-8,14,17-18,31H,2-4,9-13,24H2,1H3,(H2,25,33)(H,27,32)(H,28,35)(H,30,34)(H3,26,29,36) |
| InChIKey | CJABVVUMJXXZAP-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|