C20H30IN6O4Se2 — CID 156638403
CID 156638403 (PubChem CID 156638403) has the molecular formula C20H30IN6O4Se2 and a molecular weight of 703.32 g/mol.
| Compound Name | CID 156638403 |
|---|---|
| PubChem CID | 156638403 |
| Molecular Formula | C20H30IN6O4Se2 |
| Molecular Weight | 703.32 g/mol |
| Exact Mass | 704.97 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1ccc(CC(N[Se]I)C(=O)NCCCCNC(=O)CCC(N[Se])C(N)=O)cc1 |
| InChI | InChI=1S/C20H30IN6O4Se2/c1-13(28)25-15-6-4-14(5-7-15)12-17(27-33-21)20(31)24-11-3-2-10-23-18(29)9-8-16(26-32)19(22)30/h4-7,16-17,26-27H,2-3,8-12H2,1H3,(H2,22,30)(H,23,29)(H,24,31)(H,25,28) |
| InChIKey | ZUWIOZOMJHVMHI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|