C15H30N2O3Si — CID 158047382
6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-methoxypyridin-3-amine;methane (PubChem CID 158047382) has the molecular formula C15H30N2O3Si and a molecular weight of 314.50 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-methoxypyridin-3-amine;methane.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-methoxypyridin-3-amine;methane |
|---|---|
| PubChem CID | 158047382 |
| Molecular Formula | C15H30N2O3Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-methoxypyridin-3-amine;methane |
| SMILES | C.COc1cc(OCCO[Si](C)(C)C(C)(C)C)ncc1N |
| InChI | InChI=1S/C14H26N2O3Si.CH4/c1-14(2,3)20(5,6)19-8-7-18-13-9-12(17-4)11(15)10-16-13;/h9-10H,7-8,15H2,1-6H3;1H4 |
| InChIKey | FJBQBSIDVYMNCK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|