C51H39KO11S3 — CID 158047655
potassium 5-(3,4-dimethylphenyl)sulfonyl-2-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenoxy]benzenesulfonate (PubChem CID 158047655) has the molecular formula C51H39KO11S3 and a molecular weight of 963.16 g/mol. Its IUPAC name is potassium 5-(3,4-dimethylphenyl)sulfonyl-2-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenoxy]benzenesulfonate.
| Compound Name | potassium 5-(3,4-dimethylphenyl)sulfonyl-2-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenoxy]benzenesulfonate |
|---|---|
| PubChem CID | 158047655 |
| Molecular Formula | C51H39KO11S3 |
| Molecular Weight | 963.16 g/mol |
| Exact Mass | 962.13 |
| IUPAC Name | potassium 5-(3,4-dimethylphenyl)sulfonyl-2-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]phenoxy]benzenesulfonate |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Oc5ccc(-c6ccc(Oc7ccc(S(=O)(=O)c8ccc(C)c(C)c8)cc7S(=O)(=O)[O-])cc6)cc5)cc4)cc3)cc2)cc1.[K+] |
| InChI | InChI=1S/C51H40O11S3.K/c1-34-4-25-48(32-35(34)2)64(54,55)49-30-31-50(51(33-49)65(56,57)58)62-45-19-11-39(12-20-45)38-9-17-42(18-10-38)61-44-23-28-47(29-24-44)63(52,53)46-26-21-43(22-27-46)60-41-15-7-37(8-16-41)36-5-13-40(59-3)14-6-36;/h4-33H,1-3H3,(H,56,57,58);/q;+1/p-1 |
| InChIKey | SHSDOLNNVALJMV-UHFFFAOYSA-M |
| XLogP | 8.60 |
| TPSA | 162.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.16 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|