C29H26Na2O10S3 — CID 59584081
disodium;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-5-(4-methyl-3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate (PubChem CID 59584081) has the molecular formula C29H26Na2O10S3 and a molecular weight of 676.70 g/mol. Its IUPAC name is disodium;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-5-(4-methyl-3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate.
| Compound Name | disodium;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-5-(4-methyl-3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 59584081 |
| Molecular Formula | C29H26Na2O10S3 |
| Molecular Weight | 676.70 g/mol |
| Exact Mass | 676.05 |
| IUPAC Name | disodium;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-5-(4-methyl-3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate |
| SMILES | COc1ccc(C(C)(C)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(SOO[O-])c4)cc3S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C29H28O10S3.2Na/c1-19-5-14-24(17-27(19)40-39-38-30)41(31,32)25-15-16-26(28(18-25)42(33,34)35)37-23-12-8-21(9-13-23)29(2,3)20-6-10-22(36-4)11-7-20;;/h5-18,30H,1-4H3,(H,33,34,35);;/q;2*+1/p-2 |
| InChIKey | LYZKVRAFBYMIRN-UHFFFAOYSA-L |
| XLogP | -0.90 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.70 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|