C26H20Na2O7S2 — CID 58185863
disodium;2-[4-(4-methoxyphenyl)phenoxy]-5-(4-methylbenzene-5-id-1-yl)sulfonylbenzenesulfonate (PubChem CID 58185863) has the molecular formula C26H20Na2O7S2 and a molecular weight of 554.55 g/mol. Its IUPAC name is disodium;2-[4-(4-methoxyphenyl)phenoxy]-5-(4-methylbenzene-5-id-1-yl)sulfonylbenzenesulfonate.
| Compound Name | disodium;2-[4-(4-methoxyphenyl)phenoxy]-5-(4-methylbenzene-5-id-1-yl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 58185863 |
| Molecular Formula | C26H20Na2O7S2 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | disodium;2-[4-(4-methoxyphenyl)phenoxy]-5-(4-methylbenzene-5-id-1-yl)sulfonylbenzenesulfonate |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4c[c-]c(C)cc4)cc3S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C26H21O7S2.2Na/c1-18-3-13-23(14-4-18)34(27,28)24-15-16-25(26(17-24)35(29,30)31)33-22-11-7-20(8-12-22)19-5-9-21(32-2)10-6-19;;/h3,5-17H,1-2H3,(H,29,30,31);;/q-1;2*+1/p-1 |
| InChIKey | YDGNKKPTQRRLJD-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|