C21H17NaO6S — CID 140825033
sodium 2-[4-(4-methoxybenzoyl)phenoxy]-5-methylbenzenesulfonate (PubChem CID 140825033) has the molecular formula C21H17NaO6S and a molecular weight of 420.42 g/mol. Its IUPAC name is sodium 2-[4-(4-methoxybenzoyl)phenoxy]-5-methylbenzenesulfonate.
| Compound Name | sodium 2-[4-(4-methoxybenzoyl)phenoxy]-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 140825033 |
| Molecular Formula | C21H17NaO6S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | sodium 2-[4-(4-methoxybenzoyl)phenoxy]-5-methylbenzenesulfonate |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3ccc(C)cc3S(=O)(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C21H18O6S.Na/c1-14-3-12-19(20(13-14)28(23,24)25)27-18-10-6-16(7-11-18)21(22)15-4-8-17(26-2)9-5-15;/h3-13H,1-2H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | GXPQSULWTFYNRK-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|