C23H23ClO5S — CID 90751241
methanesulfonyl chloride;[4-(4-methoxy-2-methylphenoxy)phenyl]-(4-methylphenyl)methanone (PubChem CID 90751241) has the molecular formula C23H23ClO5S and a molecular weight of 446.95 g/mol. Its IUPAC name is methanesulfonyl chloride;[4-(4-methoxy-2-methylphenoxy)phenyl]-(4-methylphenyl)methanone.
| Compound Name | methanesulfonyl chloride;[4-(4-methoxy-2-methylphenoxy)phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 90751241 |
| Molecular Formula | C23H23ClO5S |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | methanesulfonyl chloride;[4-(4-methoxy-2-methylphenoxy)phenyl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(Oc2ccc(C(=O)c3ccc(C)cc3)cc2)c(C)c1.CS(=O)(=O)Cl |
| InChI | InChI=1S/C22H20O3.CH3ClO2S/c1-15-4-6-17(7-5-15)22(23)18-8-10-19(11-9-18)25-21-13-12-20(24-3)14-16(21)2;1-5(2,3)4/h4-14H,1-3H3;1H3 |
| InChIKey | RFSQNFSVBKXKKA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |