C39H46O8 — CID 158051844
9H-fluoren-9-ylmethyl 4-[2-[2-(7-benzyl-2,5,8-trioxodecoxy)ethoxy]ethoxy]butanoate (PubChem CID 158051844) has the molecular formula C39H46O8 and a molecular weight of 642.79 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[2-[2-(7-benzyl-2,5,8-trioxodecoxy)ethoxy]ethoxy]butanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[2-[2-(7-benzyl-2,5,8-trioxodecoxy)ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 158051844 |
| Molecular Formula | C39H46O8 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[2-[2-(7-benzyl-2,5,8-trioxodecoxy)ethoxy]ethoxy]butanoate |
| SMILES | CCC(=O)C(CC(=O)CCC(=O)COCCOCCOCCCC(=O)OCC1c2ccccc2-c2ccccc21)Cc1ccccc1 |
| InChI | InChI=1S/C39H46O8/c1-2-38(42)30(25-29-11-4-3-5-12-29)26-31(40)18-19-32(41)27-46-24-23-45-22-21-44-20-10-17-39(43)47-28-37-35-15-8-6-13-33(35)34-14-7-9-16-36(34)37/h3-9,11-16,30,37H,2,10,17-28H2,1H3 |
| InChIKey | YKWVNQXIPGHUFR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|