C24H27BrO5 — CID 159835092
2-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 159835092) has the molecular formula C24H27BrO5 and a molecular weight of 475.38 g/mol. Its IUPAC name is 2-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 159835092 |
| Molecular Formula | C24H27BrO5 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCOCCCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27BrO5/c1-24(2,25)23(27)29-15-14-28-13-7-12-22(26)30-16-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h3-6,8-11,21H,7,12-16H2,1-2H3 |
| InChIKey | RERCXUWKLRTCIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|