C28H32N6O4 — CID 158051857
1-[[4-[(4-methoxyphenyl)methylamino]-6-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3,5-triazin-2-yl]methyl]pyrrolidine-2,4-dione (PubChem CID 158051857) has the molecular formula C28H32N6O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 1-[[4-[(4-methoxyphenyl)methylamino]-6-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3,5-triazin-2-yl]methyl]pyrrolidine-2,4-dione.
| Compound Name | 1-[[4-[(4-methoxyphenyl)methylamino]-6-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3,5-triazin-2-yl]methyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 158051857 |
| Molecular Formula | C28H32N6O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 1-[[4-[(4-methoxyphenyl)methylamino]-6-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3,5-triazin-2-yl]methyl]pyrrolidine-2,4-dione |
| SMILES | COc1ccc(CNc2nc(CCc3ccc(N4CCOCC4)cc3)nc(CN3CC(=O)CC3=O)n2)cc1 |
| InChI | InChI=1S/C28H32N6O4/c1-37-24-9-4-21(5-10-24)17-29-28-31-25(30-26(32-28)19-34-18-23(35)16-27(34)36)11-6-20-2-7-22(8-3-20)33-12-14-38-15-13-33/h2-5,7-10H,6,11-19H2,1H3,(H,29,30,31,32) |
| InChIKey | NLZGISFNHSPSKN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|