C32H38ClNO4 — CID 158058142
(2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-hydroxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol (PubChem CID 158058142) has the molecular formula C32H38ClNO4 and a molecular weight of 536.11 g/mol. Its IUPAC name is (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-hydroxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol.
| Compound Name | (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-hydroxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol |
|---|---|
| PubChem CID | 158058142 |
| Molecular Formula | C32H38ClNO4 |
| Molecular Weight | 536.11 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-hydroxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol |
| SMILES | C=C[C@@]1(O)CCO[C@@H]([C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(C(=C)O)cc32)C1 |
| InChI | InChI=1S/C32H38ClNO4/c1-3-32(36)13-14-37-30(17-32)26-9-6-24(26)18-34-19-31(12-4-5-23-15-25(33)8-10-27(23)31)20-38-29-11-7-22(21(2)35)16-28(29)34/h3,7-8,10-11,15-16,24,26,30,35-36H,1-2,4-6,9,12-14,17-20H2/t24-,26+,30+,31-,32+/m0/s1 |
| InChIKey | NJMRMKNZFHQCSX-JVTDYXMISA-N |
| XLogP | 6.46 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.11 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|