C33H40ClNO4 — CID 157176187
(2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-methoxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol (PubChem CID 157176187) has the molecular formula C33H40ClNO4 and a molecular weight of 550.14 g/mol. Its IUPAC name is (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-methoxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol.
| Compound Name | (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-methoxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol |
|---|---|
| PubChem CID | 157176187 |
| Molecular Formula | C33H40ClNO4 |
| Molecular Weight | 550.14 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | (2R,4R)-2-[(1R,2R)-2-[[(4S)-7-chloro-7'-(1-methoxyethenyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-5'-yl]methyl]cyclobutyl]-4-ethenyloxan-4-ol |
| SMILES | C=C[C@@]1(O)CCO[C@@H]([C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(C(=C)OC)cc32)C1 |
| InChI | InChI=1S/C33H40ClNO4/c1-4-33(36)14-15-38-31(18-33)27-10-7-25(27)19-35-20-32(13-5-6-24-16-26(34)9-11-28(24)32)21-39-30-12-8-23(17-29(30)35)22(2)37-3/h4,8-9,11-12,16-17,25,27,31,36H,1-2,5-7,10,13-15,18-21H2,3H3/t25-,27+,31+,32-,33+/m0/s1 |
| InChIKey | AJWCFVPLSRGKRX-CNXNEEMFSA-N |
| XLogP | 6.55 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.14 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|