About 1,3-oxazole;quinoline;1,3-thiazole
1,3-oxazole;quinoline;1,3-thiazole (PubChem CID 158077050) has the molecular formula C15H13N3OS
and a molecular weight of 283.36 g/mol. Its IUPAC name is 1,3-oxazole;quinoline;1,3-thiazole.
Molecular Properties
| Compound Name | 1,3-oxazole;quinoline;1,3-thiazole |
| PubChem CID | 158077050 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1,3-oxazole;quinoline;1,3-thiazole |
| SMILES | c1ccc2ncccc2c1.c1cocn1.c1cscn1 |
| InChI | InChI=1S/C9H7N.C3H3NO.C3H3NS/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-5-3-4-1/h1-7H;2*1-3H |
| InChIKey | FMMPNCQTNWHAKV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-oxazole;quinoline;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazole;quinoline;1,3-thiazole?
The IUPAC name of 1,3-oxazole;quinoline;1,3-thiazole (CID 158077050) is 1,3-oxazole;quinoline;1,3-thiazole.
What is the SMILES notation for 1,3-oxazole;quinoline;1,3-thiazole?
The canonical SMILES for 1,3-oxazole;quinoline;1,3-thiazole is c1ccc2ncccc2c1.c1cocn1.c1cscn1.
What is the InChIKey of 1,3-oxazole;quinoline;1,3-thiazole?
The InChIKey is FMMPNCQTNWHAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H3NO.C3H3NS/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-5-3-4-1/h1-7H;2*1-3H.
What are the key properties of 1,3-oxazole;quinoline;1,3-thiazole?
1,3-oxazole;quinoline;1,3-thiazole has a molecular weight of 283.36 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazole;quinoline;1,3-thiazole is sourced from PubChem (CID 158077050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).