C34H34ClN3O6 — CID 158079589
3-[(1-benzyl-4-hydroxypiperidin-4-yl)-(4-chlorophenyl)methyl]-2-methoxyquinoline-6-carbonitrile;1-hydroperoxyperoxybut-2-yne (PubChem CID 158079589) has the molecular formula C34H34ClN3O6 and a molecular weight of 616.11 g/mol. Its IUPAC name is 3-[(1-benzyl-4-hydroxypiperidin-4-yl)-(4-chlorophenyl)methyl]-2-methoxyquinoline-6-carbonitrile;1-hydroperoxyperoxybut-2-yne.
| Compound Name | 3-[(1-benzyl-4-hydroxypiperidin-4-yl)-(4-chlorophenyl)methyl]-2-methoxyquinoline-6-carbonitrile;1-hydroperoxyperoxybut-2-yne |
|---|---|
| PubChem CID | 158079589 |
| Molecular Formula | C34H34ClN3O6 |
| Molecular Weight | 616.11 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 3-[(1-benzyl-4-hydroxypiperidin-4-yl)-(4-chlorophenyl)methyl]-2-methoxyquinoline-6-carbonitrile;1-hydroperoxyperoxybut-2-yne |
| SMILES | CC#CCOOOO.COc1nc2ccc(C#N)cc2cc1C(c1ccc(Cl)cc1)C1(O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H28ClN3O2.C4H6O4/c1-36-29-26(18-24-17-22(19-32)7-12-27(24)33-29)28(23-8-10-25(31)11-9-23)30(35)13-15-34(16-14-30)20-21-5-3-2-4-6-21;1-2-3-4-6-8-7-5/h2-12,17-18,28,35H,13-16,20H2,1H3;5H,4H2,1H3 |
| InChIKey | FMUCLAXZZRSQEV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|