C40H54N12NiO6 — CID 158092300
bis(1,3-dicyclohexyl-5-[(5-methyl-1H-pyrazol-3-yl)diazenyl]-2,6-dioxopyrimidin-4-olate);nickel(2+) (PubChem CID 158092300) has the molecular formula C40H54N12NiO6 and a molecular weight of 857.64 g/mol. Its IUPAC name is bis(1,3-dicyclohexyl-5-[(5-methyl-1H-pyrazol-3-yl)diazenyl]-2,6-dioxopyrimidin-4-olate);nickel(2+).
| Compound Name | bis(1,3-dicyclohexyl-5-[(5-methyl-1H-pyrazol-3-yl)diazenyl]-2,6-dioxopyrimidin-4-olate);nickel(2+) |
|---|---|
| PubChem CID | 158092300 |
| Molecular Formula | C40H54N12NiO6 |
| Molecular Weight | 857.64 g/mol |
| Exact Mass | 856.36 |
| IUPAC Name | bis(1,3-dicyclohexyl-5-[(5-methyl-1H-pyrazol-3-yl)diazenyl]-2,6-dioxopyrimidin-4-olate);nickel(2+) |
| SMILES | Cc1cc(/N=N\c2c([O-])n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)n[nH]1.Cc1cc(/N=N\c2c([O-])n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)n[nH]1.[Ni+2] |
| InChI | InChI=1S/2C20H28N6O3.Ni/c2*1-13-12-16(22-21-13)23-24-17-18(27)25(14-8-4-2-5-9-14)20(29)26(19(17)28)15-10-6-3-7-11-15;/h2*12,14-15,27H,2-11H2,1H3,(H,21,22);/q;;+2/p-2/b2*24-23-; |
| InChIKey | FOGHNANOVFCMNG-QZVDAIQISA-L |
| XLogP | 7.08 |
| TPSA | 240.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|