C28H36N6O5 — CID 158067760
4-[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-6-pentan-3-ylpyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 158067760) has the molecular formula C28H36N6O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is 4-[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-6-pentan-3-ylpyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 4-[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-6-pentan-3-ylpyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 158067760 |
| Molecular Formula | C28H36N6O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 4-[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-6-pentan-3-ylpyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CCC(CC)N1C(=O)c2nccc(/N=N/c3c(O)n(C4CCCCC4)c(=O)n(C4CCCCC4)c3=O)c2C1=O |
| InChI | InChI=1S/C28H36N6O5/c1-3-17(4-2)32-24(35)21-20(15-16-29-22(21)25(32)36)30-31-23-26(37)33(18-11-7-5-8-12-18)28(39)34(27(23)38)19-13-9-6-10-14-19/h15-19,37H,3-14H2,1-2H3/b31-30+ |
| InChIKey | OVSJWYUECAPZBU-NVQSTNCTSA-N |
| XLogP | 5.32 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|