C24H52S6Si4 — CID 15809687
1,3,5,7-tetrakis(2,3-dimethylbutan-2-yl)-2,4,6,8,9,10-hexathia-1,3,5,7-tetrasilatricyclo[5.1.1.13,5]decane (PubChem CID 15809687) has the molecular formula C24H52S6Si4 and a molecular weight of 645.43 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(2,3-dimethylbutan-2-yl)-2,4,6,8,9,10-hexathia-1,3,5,7-tetrasilatricyclo[5.1.1.13,5]decane.
| Compound Name | 1,3,5,7-tetrakis(2,3-dimethylbutan-2-yl)-2,4,6,8,9,10-hexathia-1,3,5,7-tetrasilatricyclo[5.1.1.13,5]decane |
|---|---|
| PubChem CID | 15809687 |
| Molecular Formula | C24H52S6Si4 |
| Molecular Weight | 645.43 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | 1,3,5,7-tetrakis(2,3-dimethylbutan-2-yl)-2,4,6,8,9,10-hexathia-1,3,5,7-tetrasilatricyclo[5.1.1.13,5]decane |
| SMILES | CC(C)C(C)(C)[Si]12S[Si](C(C)(C)C(C)C)(S1)S[Si]1(C(C)(C)C(C)C)S[Si](C(C)(C)C(C)C)(S1)S2 |
| InChI | InChI=1S/C24H52S6Si4/c1-17(2)21(9,10)31-25-32(26-31,22(11,12)18(3)4)30-34(24(15,16)20(7)8)27-33(28-34,29-31)23(13,14)19(5)6/h17-20H,1-16H3 |
| InChIKey | FRYHZYFWVZQREB-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.43 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|