C15H18N4O3S2 — CID 158101375
N-[5-amino-2-(piperidine-1-carbonyl)phenyl]-1,3-thiazole-4-sulfonamide (PubChem CID 158101375) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[5-amino-2-(piperidine-1-carbonyl)phenyl]-1,3-thiazole-4-sulfonamide.
| Compound Name | N-[5-amino-2-(piperidine-1-carbonyl)phenyl]-1,3-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 158101375 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[5-amino-2-(piperidine-1-carbonyl)phenyl]-1,3-thiazole-4-sulfonamide |
| SMILES | Nc1ccc(C(=O)N2CCCCC2)c(NS(=O)(=O)c2cscn2)c1 |
| InChI | InChI=1S/C15H18N4O3S2/c16-11-4-5-12(15(20)19-6-2-1-3-7-19)13(8-11)18-24(21,22)14-9-23-10-17-14/h4-5,8-10,18H,1-3,6-7,16H2 |
| InChIKey | FPHKSOBTQFUFLN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|