C28H24BBrF4N2O2 — CID 158103794
5-bromo-2-(2,6-difluorophenyl)pyridine;2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 158103794) has the molecular formula C28H24BBrF4N2O2 and a molecular weight of 587.22 g/mol. Its IUPAC name is 5-bromo-2-(2,6-difluorophenyl)pyridine;2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 5-bromo-2-(2,6-difluorophenyl)pyridine;2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 158103794 |
| Molecular Formula | C28H24BBrF4N2O2 |
| Molecular Weight | 587.22 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | 5-bromo-2-(2,6-difluorophenyl)pyridine;2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3c(F)cccc3F)nc2)OC1(C)C.Fc1cccc(F)c1-c1ccc(Br)cn1 |
| InChI | InChI=1S/C17H18BF2NO2.C11H6BrF2N/c1-16(2)17(3,4)23-18(22-16)11-8-9-14(21-10-11)15-12(19)6-5-7-13(15)20;12-7-4-5-10(15-6-7)11-8(13)2-1-3-9(11)14/h5-10H,1-4H3;1-6H |
| InChIKey | FPOXVVYFRKUWAL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.22 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|