C31H23BBr2F2N4 — CID 139038746
5,11-dibromo-2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139038746) has the molecular formula C31H23BBr2F2N4 and a molecular weight of 660.17 g/mol. Its IUPAC name is 5,11-dibromo-2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 5,11-dibromo-2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139038746 |
| Molecular Formula | C31H23BBr2F2N4 |
| Molecular Weight | 660.17 g/mol |
| Exact Mass | 658.04 |
| IUPAC Name | 5,11-dibromo-2,2-difluoro-6,10-dimethyl-8-phenyl-4,12-bis[(E)-2-pyridin-4-ylethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(Br)C(/C=C/c2ccncc2)=[N+]2C1=C(c1ccccc1)c1c(C)c(Br)c(/C=C/c3ccncc3)n1[B-]2(F)F |
| InChI | InChI=1S/C31H23BBr2F2N4/c1-20-28(33)25(10-8-22-12-16-37-17-13-22)39-30(20)27(24-6-4-3-5-7-24)31-21(2)29(34)26(40(31)32(39,35)36)11-9-23-14-18-38-19-15-23/h3-19H,1-2H3/b10-8+,11-9+ |
| InChIKey | KYKKWBGNMBINSK-GFULKKFKSA-N |
| XLogP | 8.36 |
| TPSA | 33.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.17 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|