C32H30BF2I2N5 — CID 139185891
1-[4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 139185891) has the molecular formula C32H30BF2I2N5 and a molecular weight of 787.24 g/mol. Its IUPAC name is 1-[4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-[4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 139185891 |
| Molecular Formula | C32H30BF2I2N5 |
| Molecular Weight | 787.24 g/mol |
| Exact Mass | 787.07 |
| IUPAC Name | 1-[4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc(CN(Cc3ccccn3)Cc3ccccn3)cc1)c1c(C)c(I)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C32H30BF2I2N5/c1-20-29(36)22(3)41-31(20)28(32-21(2)30(37)23(4)42(32)33(41,34)35)25-13-11-24(12-14-25)17-40(18-26-9-5-7-15-38-26)19-27-10-6-8-16-39-27/h5-16H,17-19H2,1-4H3 |
| InChIKey | NQMZEIVLTBFHIX-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 36.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.24 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|